About 1,3-diethyl-2,4-diisocyano-5-methylbenzene
1,3-diethyl-2,4-diisocyano-5-methylbenzene (PubChem CID 154085426) has the molecular formula C13H14N2
and a molecular weight of 198.27 g/mol. Its IUPAC name is 1,3-diethyl-2,4-diisocyano-5-methylbenzene.
Molecular Properties
| Compound Name | 1,3-diethyl-2,4-diisocyano-5-methylbenzene |
| PubChem CID | 154085426 |
| Molecular Formula | C13H14N2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 1,3-diethyl-2,4-diisocyano-5-methylbenzene |
| SMILES | [C-]#[N+]c1c(C)cc(CC)c([N+]#[C-])c1CC |
| InChI | InChI=1S/C13H14N2/c1-6-10-8-9(3)12(14-4)11(7-2)13(10)15-5/h8H,6-7H2,1-3H3 |
| InChIKey | DIGPEOVEWNNGLU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 8.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1,3-diethyl-2,4-diisocyano-5-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-diethyl-2,4-diisocyano-5-methylbenzene?
The IUPAC name of 1,3-diethyl-2,4-diisocyano-5-methylbenzene (CID 154085426) is 1,3-diethyl-2,4-diisocyano-5-methylbenzene.
What is the SMILES notation for 1,3-diethyl-2,4-diisocyano-5-methylbenzene?
The canonical SMILES for 1,3-diethyl-2,4-diisocyano-5-methylbenzene is [C-]#[N+]c1c(C)cc(CC)c([N+]#[C-])c1CC.
What is the InChIKey of 1,3-diethyl-2,4-diisocyano-5-methylbenzene?
The InChIKey is DIGPEOVEWNNGLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2/c1-6-10-8-9(3)12(14-4)11(7-2)13(10)15-5/h8H,6-7H2,1-3H3.
What are the key properties of 1,3-diethyl-2,4-diisocyano-5-methylbenzene?
1,3-diethyl-2,4-diisocyano-5-methylbenzene has a molecular weight of 198.27 g/mol, XLogP of 4.22, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-diethyl-2,4-diisocyano-5-methylbenzene is sourced from PubChem (CID 154085426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).