C13H14N2 — CID 154085426
1,3-diethyl-2,4-diisocyano-5-methylbenzene (PubChem CID 154085426) has the molecular formula C13H14N2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 1,3-diethyl-2,4-diisocyano-5-methylbenzene.
| Compound Name | 1,3-diethyl-2,4-diisocyano-5-methylbenzene |
|---|---|
| PubChem CID | 154085426 |
| Molecular Formula | C13H14N2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 1,3-diethyl-2,4-diisocyano-5-methylbenzene |
| SMILES | [C-]#[N+]c1c(C)cc(CC)c([N+]#[C-])c1CC |
| InChI | InChI=1S/C13H14N2/c1-6-10-8-9(3)12(14-4)11(7-2)13(10)15-5/h8H,6-7H2,1-3H3 |
| InChIKey | DIGPEOVEWNNGLU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 8.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|