About 1-ethyl-2,3-diisocyanobenzene
1-ethyl-2,3-diisocyanobenzene (PubChem CID 141039970) has the molecular formula C10H8N2
and a molecular weight of 156.19 g/mol. Its IUPAC name is 1-ethyl-2,3-diisocyanobenzene.
Molecular Properties
| Compound Name | 1-ethyl-2,3-diisocyanobenzene |
| PubChem CID | 141039970 |
| Molecular Formula | C10H8N2 |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | 1-ethyl-2,3-diisocyanobenzene |
| SMILES | [C-]#[N+]c1cccc(CC)c1[N+]#[C-] |
| InChI | InChI=1S/C10H8N2/c1-4-8-6-5-7-9(11-2)10(8)12-3/h5-7H,4H2,1H3 |
| InChIKey | XIOAUBWGXQAIOR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 8.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-2,3-diisocyanobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2,3-diisocyanobenzene?
The IUPAC name of 1-ethyl-2,3-diisocyanobenzene (CID 141039970) is 1-ethyl-2,3-diisocyanobenzene.
What is the SMILES notation for 1-ethyl-2,3-diisocyanobenzene?
The canonical SMILES for 1-ethyl-2,3-diisocyanobenzene is [C-]#[N+]c1cccc(CC)c1[N+]#[C-].
What is the InChIKey of 1-ethyl-2,3-diisocyanobenzene?
The InChIKey is XIOAUBWGXQAIOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2/c1-4-8-6-5-7-9(11-2)10(8)12-3/h5-7H,4H2,1H3.
What are the key properties of 1-ethyl-2,3-diisocyanobenzene?
1-ethyl-2,3-diisocyanobenzene has a molecular weight of 156.19 g/mol, XLogP of 3.35, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2,3-diisocyanobenzene is sourced from PubChem (CID 141039970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).