C8H8ClF2NO — CID 130083780
3-(chloromethyl)-6-(difluoromethyl)-4-methyl-1H-pyridin-2-one (PubChem CID 130083780) has the molecular formula C8H8ClF2NO and a molecular weight of 207.61 g/mol. Its IUPAC name is 3-(chloromethyl)-6-(difluoromethyl)-4-methyl-1H-pyridin-2-one.
| Compound Name | 3-(chloromethyl)-6-(difluoromethyl)-4-methyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 130083780 |
| Molecular Formula | C8H8ClF2NO |
| Molecular Weight | 207.61 g/mol |
| Exact Mass | 207.03 |
| IUPAC Name | 3-(chloromethyl)-6-(difluoromethyl)-4-methyl-1H-pyridin-2-one |
| SMILES | Cc1cc(C(F)F)[nH]c(=O)c1CCl |
| InChI | InChI=1S/C8H8ClF2NO/c1-4-2-6(7(10)11)12-8(13)5(4)3-9/h2,7H,3H2,1H3,(H,12,13) |
| InChIKey | QEIVGMGDFYUHII-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.61 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|