C10H10BrF2NO3 — CID 133102630
methyl 2-[4-(bromomethyl)-6-(difluoromethyl)-2-oxo-1H-pyridin-3-yl]acetate (PubChem CID 133102630) has the molecular formula C10H10BrF2NO3 and a molecular weight of 310.09 g/mol. Its IUPAC name is methyl 2-[4-(bromomethyl)-6-(difluoromethyl)-2-oxo-1H-pyridin-3-yl]acetate.
| Compound Name | methyl 2-[4-(bromomethyl)-6-(difluoromethyl)-2-oxo-1H-pyridin-3-yl]acetate |
|---|---|
| PubChem CID | 133102630 |
| Molecular Formula | C10H10BrF2NO3 |
| Molecular Weight | 310.09 g/mol |
| Exact Mass | 308.98 |
| IUPAC Name | methyl 2-[4-(bromomethyl)-6-(difluoromethyl)-2-oxo-1H-pyridin-3-yl]acetate |
| SMILES | COC(=O)Cc1c(CBr)cc(C(F)F)[nH]c1=O |
| InChI | InChI=1S/C10H10BrF2NO3/c1-17-8(15)3-6-5(4-11)2-7(9(12)13)14-10(6)16/h2,9H,3-4H2,1H3,(H,14,16) |
| InChIKey | LTPWQYLHDSCLCL-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.09 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|