C7H6BrF2NO — CID 130110117
3-bromo-6-(difluoromethyl)-4-methyl-1H-pyridin-2-one (PubChem CID 130110117) has the molecular formula C7H6BrF2NO and a molecular weight of 238.03 g/mol. Its IUPAC name is 3-bromo-6-(difluoromethyl)-4-methyl-1H-pyridin-2-one.
| Compound Name | 3-bromo-6-(difluoromethyl)-4-methyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 130110117 |
| Molecular Formula | C7H6BrF2NO |
| Molecular Weight | 238.03 g/mol |
| Exact Mass | 236.96 |
| IUPAC Name | 3-bromo-6-(difluoromethyl)-4-methyl-1H-pyridin-2-one |
| SMILES | Cc1cc(C(F)F)[nH]c(=O)c1Br |
| InChI | InChI=1S/C7H6BrF2NO/c1-3-2-4(6(9)10)11-7(12)5(3)8/h2,6H,1H3,(H,11,12) |
| InChIKey | AYZXERLMRRJEHY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.03 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |