C25H22N2O3 — CID 10294289
(E)-3-[4-(imidazol-1-ylmethyl)-2-(2-naphthalen-2-ylethoxy)phenyl]prop-2-enoic acid (PubChem CID 10294289) has the molecular formula C25H22N2O3 and a molecular weight of 398.46 g/mol. Its IUPAC name is (E)-3-[4-(imidazol-1-ylmethyl)-2-(2-naphthalen-2-ylethoxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-(imidazol-1-ylmethyl)-2-(2-naphthalen-2-ylethoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 10294289 |
| Molecular Formula | C25H22N2O3 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | (E)-3-[4-(imidazol-1-ylmethyl)-2-(2-naphthalen-2-ylethoxy)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(Cn2ccnc2)cc1OCCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C25H22N2O3/c28-25(29)10-9-22-8-6-20(17-27-13-12-26-18-27)16-24(22)30-14-11-19-5-7-21-3-1-2-4-23(21)15-19/h1-10,12-13,15-16,18H,11,14,17H2,(H,28,29)/b10-9+ |
| InChIKey | IWLZOZCKKUEBQR-MDZDMXLPSA-N |
| XLogP | 4.80 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|