C18H18N2O5 — CID 2843775
1-(3-naphthalen-2-yloxypropyl)imidazole;oxalic acid (PubChem CID 2843775) has the molecular formula C18H18N2O5 and a molecular weight of 342.35 g/mol. Its IUPAC name is 1-(3-naphthalen-2-yloxypropyl)imidazole;oxalic acid.
| Compound Name | 1-(3-naphthalen-2-yloxypropyl)imidazole;oxalic acid |
|---|---|
| PubChem CID | 2843775 |
| Molecular Formula | C18H18N2O5 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 1-(3-naphthalen-2-yloxypropyl)imidazole;oxalic acid |
| SMILES | O=C(O)C(=O)O.c1ccc2cc(OCCCn3ccnc3)ccc2c1 |
| InChI | InChI=1S/C16H16N2O.C2H2O4/c1-2-5-15-12-16(7-6-14(15)4-1)19-11-3-9-18-10-8-17-13-18;3-1(4)2(5)6/h1-2,4-8,10,12-13H,3,9,11H2;(H,3,4)(H,5,6) |
| InChIKey | OYJLRQCORVFFKZ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|