C8H11BrN2OS — CID 102943202
3-bromo-5-[2-(oxolan-2-yl)ethyl]-1,2,4-thiadiazole (PubChem CID 102943202) has the molecular formula C8H11BrN2OS and a molecular weight of 263.16 g/mol. Its IUPAC name is 3-bromo-5-[2-(oxolan-2-yl)ethyl]-1,2,4-thiadiazole.
| Compound Name | 3-bromo-5-[2-(oxolan-2-yl)ethyl]-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 102943202 |
| Molecular Formula | C8H11BrN2OS |
| Molecular Weight | 263.16 g/mol |
| Exact Mass | 261.98 |
| IUPAC Name | 3-bromo-5-[2-(oxolan-2-yl)ethyl]-1,2,4-thiadiazole |
| SMILES | Brc1nsc(CCC2CCCO2)n1 |
| InChI | InChI=1S/C8H11BrN2OS/c9-8-10-7(13-11-8)4-3-6-2-1-5-12-6/h6H,1-5H2 |
| InChIKey | KZZJYBKCXGWNAQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.16 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |