C7H11BrN2OS — CID 102943451
3-bromo-5-(3-methoxybutyl)-1,2,4-thiadiazole (PubChem CID 102943451) has the molecular formula C7H11BrN2OS and a molecular weight of 251.15 g/mol. Its IUPAC name is 3-bromo-5-(3-methoxybutyl)-1,2,4-thiadiazole.
| Compound Name | 3-bromo-5-(3-methoxybutyl)-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 102943451 |
| Molecular Formula | C7H11BrN2OS |
| Molecular Weight | 251.15 g/mol |
| Exact Mass | 249.98 |
| IUPAC Name | 3-bromo-5-(3-methoxybutyl)-1,2,4-thiadiazole |
| SMILES | COC(C)CCc1nc(Br)ns1 |
| InChI | InChI=1S/C7H11BrN2OS/c1-5(11-2)3-4-6-9-7(8)10-12-6/h5H,3-4H2,1-2H3 |
| InChIKey | IQDYSBNTMOXDSH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.15 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |