C8H11BrN2S — CID 102943235
3-bromo-5-(1-methylcyclopentyl)-1,2,4-thiadiazole (PubChem CID 102943235) has the molecular formula C8H11BrN2S and a molecular weight of 247.16 g/mol. Its IUPAC name is 3-bromo-5-(1-methylcyclopentyl)-1,2,4-thiadiazole.
| Compound Name | 3-bromo-5-(1-methylcyclopentyl)-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 102943235 |
| Molecular Formula | C8H11BrN2S |
| Molecular Weight | 247.16 g/mol |
| Exact Mass | 245.98 |
| IUPAC Name | 3-bromo-5-(1-methylcyclopentyl)-1,2,4-thiadiazole |
| SMILES | CC1(c2nc(Br)ns2)CCCC1 |
| InChI | InChI=1S/C8H11BrN2S/c1-8(4-2-3-5-8)6-10-7(9)11-12-6/h2-5H2,1H3 |
| InChIKey | NDLJQUSDCRJIMH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.16 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |