C11H6BrN3S — CID 102943433
3-bromo-5-quinolin-6-yl-1,2,4-thiadiazole (PubChem CID 102943433) has the molecular formula C11H6BrN3S and a molecular weight of 292.16 g/mol. Its IUPAC name is 3-bromo-5-quinolin-6-yl-1,2,4-thiadiazole.
| Compound Name | 3-bromo-5-quinolin-6-yl-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 102943433 |
| Molecular Formula | C11H6BrN3S |
| Molecular Weight | 292.16 g/mol |
| Exact Mass | 290.95 |
| IUPAC Name | 3-bromo-5-quinolin-6-yl-1,2,4-thiadiazole |
| SMILES | Brc1nsc(-c2ccc3ncccc3c2)n1 |
| InChI | InChI=1S/C11H6BrN3S/c12-11-14-10(16-15-11)8-3-4-9-7(6-8)2-1-5-13-9/h1-6H |
| InChIKey | MGJGLGJXXHZZPN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.16 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |