C10H5ClN4S — CID 102944118
3-chloro-5-quinoxalin-5-yl-1,2,4-thiadiazole (PubChem CID 102944118) has the molecular formula C10H5ClN4S and a molecular weight of 248.70 g/mol. Its IUPAC name is 3-chloro-5-quinoxalin-5-yl-1,2,4-thiadiazole.
| Compound Name | 3-chloro-5-quinoxalin-5-yl-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 102944118 |
| Molecular Formula | C10H5ClN4S |
| Molecular Weight | 248.70 g/mol |
| Exact Mass | 247.99 |
| IUPAC Name | 3-chloro-5-quinoxalin-5-yl-1,2,4-thiadiazole |
| SMILES | Clc1nsc(-c2cccc3nccnc23)n1 |
| InChI | InChI=1S/C10H5ClN4S/c11-10-14-9(16-15-10)6-2-1-3-7-8(6)13-5-4-12-7/h1-5H |
| InChIKey | JSXZKLCLGLDFKD-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.70 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |