C12H11N5O — CID 104615619
2-(5-quinoxalin-5-yl-1,2,4-oxadiazol-3-yl)ethanamine (PubChem CID 104615619) has the molecular formula C12H11N5O and a molecular weight of 241.25 g/mol. Its IUPAC name is 2-(5-quinoxalin-5-yl-1,2,4-oxadiazol-3-yl)ethanamine.
| Compound Name | 2-(5-quinoxalin-5-yl-1,2,4-oxadiazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 104615619 |
| Molecular Formula | C12H11N5O |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 2-(5-quinoxalin-5-yl-1,2,4-oxadiazol-3-yl)ethanamine |
| SMILES | NCCc1noc(-c2cccc3nccnc23)n1 |
| InChI | InChI=1S/C12H11N5O/c13-5-4-10-16-12(18-17-10)8-2-1-3-9-11(8)15-7-6-14-9/h1-3,6-7H,4-5,13H2 |
| InChIKey | SLFYMCKHULAAAU-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 90.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |