C15H9N5O — CID 39819329
3-pyridin-2-yl-5-quinoxalin-5-yl-1,2,4-oxadiazole (PubChem CID 39819329) has the molecular formula C15H9N5O and a molecular weight of 275.27 g/mol. Its IUPAC name is 3-pyridin-2-yl-5-quinoxalin-5-yl-1,2,4-oxadiazole.
| Compound Name | 3-pyridin-2-yl-5-quinoxalin-5-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 39819329 |
| Molecular Formula | C15H9N5O |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 3-pyridin-2-yl-5-quinoxalin-5-yl-1,2,4-oxadiazole |
| SMILES | c1ccc(-c2noc(-c3cccc4nccnc34)n2)nc1 |
| InChI | InChI=1S/C15H9N5O/c1-2-7-16-12(5-1)14-19-15(21-20-14)10-4-3-6-11-13(10)18-9-8-17-11/h1-9H |
| InChIKey | YKPKRWIOJGVXLW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 77.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |