C8H3ClF2N2S — CID 102944122
3-chloro-5-(3,4-difluorophenyl)-1,2,4-thiadiazole (PubChem CID 102944122) has the molecular formula C8H3ClF2N2S and a molecular weight of 232.64 g/mol. Its IUPAC name is 3-chloro-5-(3,4-difluorophenyl)-1,2,4-thiadiazole.
| Compound Name | 3-chloro-5-(3,4-difluorophenyl)-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 102944122 |
| Molecular Formula | C8H3ClF2N2S |
| Molecular Weight | 232.64 g/mol |
| Exact Mass | 231.97 |
| IUPAC Name | 3-chloro-5-(3,4-difluorophenyl)-1,2,4-thiadiazole |
| SMILES | Fc1ccc(-c2nc(Cl)ns2)cc1F |
| InChI | InChI=1S/C8H3ClF2N2S/c9-8-12-7(14-13-8)4-1-2-5(10)6(11)3-4/h1-3H |
| InChIKey | IZSVGVGAMOXKPI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.64 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |