C10H7F2NS2 — CID 116885934
2-(3,4-difluorophenyl)-4-methyl-1,3-thiazole-5-thiol (PubChem CID 116885934) has the molecular formula C10H7F2NS2 and a molecular weight of 243.30 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-4-methyl-1,3-thiazole-5-thiol.
| Compound Name | 2-(3,4-difluorophenyl)-4-methyl-1,3-thiazole-5-thiol |
|---|---|
| PubChem CID | 116885934 |
| Molecular Formula | C10H7F2NS2 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.00 |
| IUPAC Name | 2-(3,4-difluorophenyl)-4-methyl-1,3-thiazole-5-thiol |
| SMILES | Cc1nc(-c2ccc(F)c(F)c2)sc1S |
| InChI | InChI=1S/C10H7F2NS2/c1-5-10(14)15-9(13-5)6-2-3-7(11)8(12)4-6/h2-4,14H,1H3 |
| InChIKey | AEMXSZJVTMUZJZ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|