C9H9NS3 — CID 116885996
4-methyl-2-(3-methylthiophen-2-yl)-1,3-thiazole-5-thiol (PubChem CID 116885996) has the molecular formula C9H9NS3 and a molecular weight of 227.38 g/mol. Its IUPAC name is 4-methyl-2-(3-methylthiophen-2-yl)-1,3-thiazole-5-thiol.
| Compound Name | 4-methyl-2-(3-methylthiophen-2-yl)-1,3-thiazole-5-thiol |
|---|---|
| PubChem CID | 116885996 |
| Molecular Formula | C9H9NS3 |
| Molecular Weight | 227.38 g/mol |
| Exact Mass | 226.99 |
| IUPAC Name | 4-methyl-2-(3-methylthiophen-2-yl)-1,3-thiazole-5-thiol |
| SMILES | Cc1ccsc1-c1nc(C)c(S)s1 |
| InChI | InChI=1S/C9H9NS3/c1-5-3-4-12-7(5)8-10-6(2)9(11)13-8/h3-4,11H,1-2H3 |
| InChIKey | ZOLNEHCEIPQTBE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|