(2R,5S)-5-(cyclooctylcarbamoyl)oxolane-2-carboxylic acid

C14H23NO4 — CID 102944337

IUPAC(2R,5S)-5-(cyclooctylcarbamoyl)oxolane-2-carboxylic acid
SMILESO=C(NC1CCCCCCC1)[C@@H]1CC[C@H](C(=O)O)O1
InChIInChI=1S/C14H23NO4/c16-13(11-8-9-12(19-11)14(17)18)15-10-6-4-2-1-3-5-7-10/h10-12H,1-9H2,(H,15,16)(H,17,18)/t11-,12+/m0/s1
InChIKeyRXSGDHSIYBODGS-NWDGAFQWSA-N
MW269.34 g/mol
LogP1.85
Rot. Bonds3

About (2R,5S)-5-(cyclooctylcarbamoyl)oxolane-2-carboxylic acid

(2R,5S)-5-(cyclooctylcarbamoyl)oxolane-2-carboxylic acid (PubChem CID 102944337) has the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. Its IUPAC name is (2R,5S)-5-(cyclooctylcarbamoyl)oxolane-2-carboxylic acid.

Molecular Properties

Compound Name(2R,5S)-5-(cyclooctylcarbamoyl)oxolane-2-carboxylic acid
PubChem CID102944337
Molecular FormulaC14H23NO4
Molecular Weight269.34 g/mol
Exact Mass269.16
IUPAC Name(2R,5S)-5-(cyclooctylcarbamoyl)oxolane-2-carboxylic acid
SMILESO=C(NC1CCCCCCC1)[C@@H]1CC[C@H](C(=O)O)O1
InChIInChI=1S/C14H23NO4/c16-13(11-8-9-12(19-11)14(17)18)15-10-6-4-2-1-3-5-7-10/h10-12H,1-9H2,(H,15,16)(H,17,18)/t11-,12+/m0/s1
InChIKeyRXSGDHSIYBODGS-NWDGAFQWSA-N
XLogP1.85
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500269.34
LogP ≤ 51.85
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze (2R,5S)-5-(cyclooctylcarbamoyl)oxolane-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R,5S)-5-(cyclooctylcarbamoyl)oxolane-2-carboxylic acid?
The IUPAC name of (2R,5S)-5-(cyclooctylcarbamoyl)oxolane-2-carboxylic acid (CID 102944337) is (2R,5S)-5-(cyclooctylcarbamoyl)oxolane-2-carboxylic acid.
What is the SMILES notation for (2R,5S)-5-(cyclooctylcarbamoyl)oxolane-2-carboxylic acid?
The canonical SMILES for (2R,5S)-5-(cyclooctylcarbamoyl)oxolane-2-carboxylic acid is O=C(NC1CCCCCCC1)[C@@H]1CC[C@H](C(=O)O)O1.
What is the InChIKey of (2R,5S)-5-(cyclooctylcarbamoyl)oxolane-2-carboxylic acid?
The InChIKey is RXSGDHSIYBODGS-NWDGAFQWSA-N. The full InChI is InChI=1S/C14H23NO4/c16-13(11-8-9-12(19-11)14(17)18)15-10-6-4-2-1-3-5-7-10/h10-12H,1-9H2,(H,15,16)(H,17,18)/t11-,12+/m0/s1.
What are the key properties of (2R,5S)-5-(cyclooctylcarbamoyl)oxolane-2-carboxylic acid?
(2R,5S)-5-(cyclooctylcarbamoyl)oxolane-2-carboxylic acid has a molecular weight of 269.34 g/mol, XLogP of 1.85, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5S)-5-(cyclooctylcarbamoyl)oxolane-2-carboxylic acid is sourced from PubChem (CID 102944337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).