C6H8O5 — CID 12667635
(2R,5S)-oxolane-2,5-dicarboxylic acid (PubChem CID 12667635) has the molecular formula C6H8O5 and a molecular weight of 160.12 g/mol. Its IUPAC name is (2R,5S)-oxolane-2,5-dicarboxylic acid.
| Compound Name | (2R,5S)-oxolane-2,5-dicarboxylic acid |
|---|---|
| PubChem CID | 12667635 |
| Molecular Formula | C6H8O5 |
| Molecular Weight | 160.12 g/mol |
| Exact Mass | 160.04 |
| IUPAC Name | (2R,5S)-oxolane-2,5-dicarboxylic acid |
| SMILES | O=C(O)[C@@H]1CC[C@H](C(=O)O)O1 |
| InChI | InChI=1S/C6H8O5/c7-5(8)3-1-2-4(11-3)6(9)10/h3-4H,1-2H2,(H,7,8)(H,9,10)/t3-,4+ |
| InChIKey | CWZQRDJXBMLSTF-ZXZARUISSA-N |
| XLogP | -0.30 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.12 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |