C7H11NO5 — CID 131204169
(2S,5R)-5-(methoxycarbamoyl)oxolane-2-carboxylic acid (PubChem CID 131204169) has the molecular formula C7H11NO5 and a molecular weight of 189.17 g/mol. Its IUPAC name is (2S,5R)-5-(methoxycarbamoyl)oxolane-2-carboxylic acid.
| Compound Name | (2S,5R)-5-(methoxycarbamoyl)oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 131204169 |
| Molecular Formula | C7H11NO5 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | (2S,5R)-5-(methoxycarbamoyl)oxolane-2-carboxylic acid |
| SMILES | CONC(=O)[C@H]1CC[C@@H](C(=O)O)O1 |
| InChI | InChI=1S/C7H11NO5/c1-12-8-6(9)4-2-3-5(13-4)7(10)11/h4-5H,2-3H2,1H3,(H,8,9)(H,10,11)/t4-,5+/m1/s1 |
| InChIKey | FNKSEXWEZPLCKU-UHNVWZDZSA-N |
| XLogP | -0.70 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|