C11H18N2O4 — CID 102945045
(2R,5S)-5-(4-aminopiperidine-1-carbonyl)oxolane-2-carboxylic acid (PubChem CID 102945045) has the molecular formula C11H18N2O4 and a molecular weight of 242.27 g/mol. Its IUPAC name is (2R,5S)-5-(4-aminopiperidine-1-carbonyl)oxolane-2-carboxylic acid.
| Compound Name | (2R,5S)-5-(4-aminopiperidine-1-carbonyl)oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 102945045 |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | (2R,5S)-5-(4-aminopiperidine-1-carbonyl)oxolane-2-carboxylic acid |
| SMILES | NC1CCN(C(=O)[C@@H]2CC[C@H](C(=O)O)O2)CC1 |
| InChI | InChI=1S/C11H18N2O4/c12-7-3-5-13(6-4-7)10(14)8-1-2-9(17-8)11(15)16/h7-9H,1-6,12H2,(H,15,16)/t8-,9+/m0/s1 |
| InChIKey | MSDGHCZRDOMLLJ-DTWKUNHWSA-N |
| XLogP | -0.43 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |