C13H14BrF2N3O — CID 102946674
(1R)-1-[4-bromo-2-[[1-(difluoromethyl)imidazol-2-yl]methoxy]phenyl]ethanamine (PubChem CID 102946674) has the molecular formula C13H14BrF2N3O and a molecular weight of 346.18 g/mol. Its IUPAC name is (1R)-1-[4-bromo-2-[[1-(difluoromethyl)imidazol-2-yl]methoxy]phenyl]ethanamine.
| Compound Name | (1R)-1-[4-bromo-2-[[1-(difluoromethyl)imidazol-2-yl]methoxy]phenyl]ethanamine |
|---|---|
| PubChem CID | 102946674 |
| Molecular Formula | C13H14BrF2N3O |
| Molecular Weight | 346.18 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | (1R)-1-[4-bromo-2-[[1-(difluoromethyl)imidazol-2-yl]methoxy]phenyl]ethanamine |
| SMILES | C[C@@H](N)c1ccc(Br)cc1OCc1nccn1C(F)F |
| InChI | InChI=1S/C13H14BrF2N3O/c1-8(17)10-3-2-9(14)6-11(10)20-7-12-18-4-5-19(12)13(15)16/h2-6,8,13H,7,17H2,1H3/t8-/m1/s1 |
| InChIKey | RVJWWALZPXRXBM-MRVPVSSYSA-N |
| XLogP | 3.64 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.18 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |