C13H15F2N3O — CID 55191156
(1S)-1-[3-[[1-(difluoromethyl)imidazol-2-yl]methoxy]phenyl]ethanamine (PubChem CID 55191156) has the molecular formula C13H15F2N3O and a molecular weight of 267.28 g/mol. Its IUPAC name is (1S)-1-[3-[[1-(difluoromethyl)imidazol-2-yl]methoxy]phenyl]ethanamine.
| Compound Name | (1S)-1-[3-[[1-(difluoromethyl)imidazol-2-yl]methoxy]phenyl]ethanamine |
|---|---|
| PubChem CID | 55191156 |
| Molecular Formula | C13H15F2N3O |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | (1S)-1-[3-[[1-(difluoromethyl)imidazol-2-yl]methoxy]phenyl]ethanamine |
| SMILES | C[C@H](N)c1cccc(OCc2nccn2C(F)F)c1 |
| InChI | InChI=1S/C13H15F2N3O/c1-9(16)10-3-2-4-11(7-10)19-8-12-17-5-6-18(12)13(14)15/h2-7,9,13H,8,16H2,1H3/t9-/m0/s1 |
| InChIKey | MHLSRJWNOAGDMN-VIFPVBQESA-N |
| XLogP | 2.88 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |