C15H18F2N2O — CID 103606232
2-[(4-butan-2-ylphenoxy)methyl]-1-(difluoromethyl)imidazole (PubChem CID 103606232) has the molecular formula C15H18F2N2O and a molecular weight of 280.32 g/mol. Its IUPAC name is 2-[(4-butan-2-ylphenoxy)methyl]-1-(difluoromethyl)imidazole.
| Compound Name | 2-[(4-butan-2-ylphenoxy)methyl]-1-(difluoromethyl)imidazole |
|---|---|
| PubChem CID | 103606232 |
| Molecular Formula | C15H18F2N2O |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 2-[(4-butan-2-ylphenoxy)methyl]-1-(difluoromethyl)imidazole |
| SMILES | CCC(C)c1ccc(OCc2nccn2C(F)F)cc1 |
| InChI | InChI=1S/C15H18F2N2O/c1-3-11(2)12-4-6-13(7-5-12)20-10-14-18-8-9-19(14)15(16)17/h4-9,11,15H,3,10H2,1-2H3 |
| InChIKey | GEVDWYIUAVPPJN-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |