About 5-[2-[1-[2,2-bis(4-chlorophenyl)ethyl]pyrrolidin-3-yl]ethyl]-1H-imidazole
5-[2-[1-[2,2-bis(4-chlorophenyl)ethyl]pyrrolidin-3-yl]ethyl]-1H-imidazole (PubChem CID 10295263) has the molecular formula C23H25Cl2N3
and a molecular weight of 414.38 g/mol. Its IUPAC name is 5-[2-[1-[2,2-bis(4-chlorophenyl)ethyl]pyrrolidin-3-yl]ethyl]-1H-imidazole.
Molecular Properties
| Compound Name | 5-[2-[1-[2,2-bis(4-chlorophenyl)ethyl]pyrrolidin-3-yl]ethyl]-1H-imidazole |
| PubChem CID | 10295263 |
| Molecular Formula | C23H25Cl2N3 |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 5-[2-[1-[2,2-bis(4-chlorophenyl)ethyl]pyrrolidin-3-yl]ethyl]-1H-imidazole |
| SMILES | Clc1ccc(C(CN2CCC(CCc3cnc[nH]3)C2)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H25Cl2N3/c24-20-6-2-18(3-7-20)23(19-4-8-21(25)9-5-19)15-28-12-11-17(14-28)1-10-22-13-26-16-27-22/h2-9,13,16-17,23H,1,10-12,14-15H2,(H,26,27) |
| InChIKey | RNVSSNFHWMOWRB-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[2-[1-[2,2-bis(4-chlorophenyl)ethyl]pyrrolidin-3-yl]ethyl]-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-[1-[2,2-bis(4-chlorophenyl)ethyl]pyrrolidin-3-yl]ethyl]-1H-imidazole?
The IUPAC name of 5-[2-[1-[2,2-bis(4-chlorophenyl)ethyl]pyrrolidin-3-yl]ethyl]-1H-imidazole (CID 10295263) is 5-[2-[1-[2,2-bis(4-chlorophenyl)ethyl]pyrrolidin-3-yl]ethyl]-1H-imidazole.
What is the SMILES notation for 5-[2-[1-[2,2-bis(4-chlorophenyl)ethyl]pyrrolidin-3-yl]ethyl]-1H-imidazole?
The canonical SMILES for 5-[2-[1-[2,2-bis(4-chlorophenyl)ethyl]pyrrolidin-3-yl]ethyl]-1H-imidazole is Clc1ccc(C(CN2CCC(CCc3cnc[nH]3)C2)c2ccc(Cl)cc2)cc1.
What is the InChIKey of 5-[2-[1-[2,2-bis(4-chlorophenyl)ethyl]pyrrolidin-3-yl]ethyl]-1H-imidazole?
The InChIKey is RNVSSNFHWMOWRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25Cl2N3/c24-20-6-2-18(3-7-20)23(19-4-8-21(25)9-5-19)15-28-12-11-17(14-28)1-10-22-13-26-16-27-22/h2-9,13,16-17,23H,1,10-12,14-15H2,(H,26,27).
What are the key properties of 5-[2-[1-[2,2-bis(4-chlorophenyl)ethyl]pyrrolidin-3-yl]ethyl]-1H-imidazole?
5-[2-[1-[2,2-bis(4-chlorophenyl)ethyl]pyrrolidin-3-yl]ethyl]-1H-imidazole has a molecular weight of 414.38 g/mol, XLogP of 5.80, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-[1-[2,2-bis(4-chlorophenyl)ethyl]pyrrolidin-3-yl]ethyl]-1H-imidazole is sourced from PubChem (CID 10295263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).