C23H25Cl2N3 — CID 10295263
5-[2-[1-[2,2-bis(4-chlorophenyl)ethyl]pyrrolidin-3-yl]ethyl]-1H-imidazole (PubChem CID 10295263) has the molecular formula C23H25Cl2N3 and a molecular weight of 414.38 g/mol. Its IUPAC name is 5-[2-[1-[2,2-bis(4-chlorophenyl)ethyl]pyrrolidin-3-yl]ethyl]-1H-imidazole.
| Compound Name | 5-[2-[1-[2,2-bis(4-chlorophenyl)ethyl]pyrrolidin-3-yl]ethyl]-1H-imidazole |
|---|---|
| PubChem CID | 10295263 |
| Molecular Formula | C23H25Cl2N3 |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 5-[2-[1-[2,2-bis(4-chlorophenyl)ethyl]pyrrolidin-3-yl]ethyl]-1H-imidazole |
| SMILES | Clc1ccc(C(CN2CCC(CCc3cnc[nH]3)C2)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H25Cl2N3/c24-20-6-2-18(3-7-20)23(19-4-8-21(25)9-5-19)15-28-12-11-17(14-28)1-10-22-13-26-16-27-22/h2-9,13,16-17,23H,1,10-12,14-15H2,(H,26,27) |
| InChIKey | RNVSSNFHWMOWRB-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |