C10H16FN3 — CID 154760047
4-(fluoromethyl)-1-(1H-imidazol-5-ylmethyl)piperidine (PubChem CID 154760047) has the molecular formula C10H16FN3 and a molecular weight of 197.26 g/mol. Its IUPAC name is 4-(fluoromethyl)-1-(1H-imidazol-5-ylmethyl)piperidine.
| Compound Name | 4-(fluoromethyl)-1-(1H-imidazol-5-ylmethyl)piperidine |
|---|---|
| PubChem CID | 154760047 |
| Molecular Formula | C10H16FN3 |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.13 |
| IUPAC Name | 4-(fluoromethyl)-1-(1H-imidazol-5-ylmethyl)piperidine |
| SMILES | FCC1CCN(Cc2cnc[nH]2)CC1 |
| InChI | InChI=1S/C10H16FN3/c11-5-9-1-3-14(4-2-9)7-10-6-12-8-13-10/h6,8-9H,1-5,7H2,(H,12,13) |
| InChIKey | RZDBGVOKHOIQHP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |