C9H17Cl2N3 — CID 174338495
1-(1H-imidazol-5-ylmethyl)piperidine;dihydrochloride (PubChem CID 174338495) has the molecular formula C9H17Cl2N3 and a molecular weight of 238.16 g/mol. Its IUPAC name is 1-(1H-imidazol-5-ylmethyl)piperidine;dihydrochloride.
| Compound Name | 1-(1H-imidazol-5-ylmethyl)piperidine;dihydrochloride |
|---|---|
| PubChem CID | 174338495 |
| Molecular Formula | C9H17Cl2N3 |
| Molecular Weight | 238.16 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 1-(1H-imidazol-5-ylmethyl)piperidine;dihydrochloride |
| SMILES | Cl.Cl.c1ncc(CN2CCCCC2)[nH]1 |
| InChI | InChI=1S/C9H15N3.2ClH/c1-2-4-12(5-3-1)7-9-6-10-8-11-9;;/h6,8H,1-5,7H2,(H,10,11);2*1H |
| InChIKey | OKLKFOCECVZWCI-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.16 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |