C18H26N4 — CID 56917910
1-(1H-imidazol-5-ylmethyl)-4-(3-phenylpropyl)-1,4-diazepane (PubChem CID 56917910) has the molecular formula C18H26N4 and a molecular weight of 298.43 g/mol. Its IUPAC name is 1-(1H-imidazol-5-ylmethyl)-4-(3-phenylpropyl)-1,4-diazepane.
| Compound Name | 1-(1H-imidazol-5-ylmethyl)-4-(3-phenylpropyl)-1,4-diazepane |
|---|---|
| PubChem CID | 56917910 |
| Molecular Formula | C18H26N4 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | 1-(1H-imidazol-5-ylmethyl)-4-(3-phenylpropyl)-1,4-diazepane |
| SMILES | c1ccc(CCCN2CCCN(Cc3cnc[nH]3)CC2)cc1 |
| InChI | InChI=1S/C18H26N4/c1-2-6-17(7-3-1)8-4-9-21-10-5-11-22(13-12-21)15-18-14-19-16-20-18/h1-3,6-7,14,16H,4-5,8-13,15H2,(H,19,20) |
| InChIKey | NQHIYPDKOPCJEX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |