C14H22N6 — CID 71447015
1,5-bis(1H-imidazol-5-ylmethyl)-1,5-diazocane (PubChem CID 71447015) has the molecular formula C14H22N6 and a molecular weight of 274.37 g/mol. Its IUPAC name is 1,5-bis(1H-imidazol-5-ylmethyl)-1,5-diazocane.
| Compound Name | 1,5-bis(1H-imidazol-5-ylmethyl)-1,5-diazocane |
|---|---|
| PubChem CID | 71447015 |
| Molecular Formula | C14H22N6 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 1,5-bis(1H-imidazol-5-ylmethyl)-1,5-diazocane |
| SMILES | c1ncc(CN2CCCN(Cc3cnc[nH]3)CCC2)[nH]1 |
| InChI | InChI=1S/C14H22N6/c1-3-19(9-13-7-15-11-17-13)5-2-6-20(4-1)10-14-8-16-12-18-14/h7-8,11-12H,1-6,9-10H2,(H,15,17)(H,16,18) |
| InChIKey | ULGOCIZWLIKJNH-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |