C10H18N4O — CID 115747077
2-[4-(1H-imidazol-5-ylmethyl)piperazin-1-yl]ethanol (PubChem CID 115747077) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is 2-[4-(1H-imidazol-5-ylmethyl)piperazin-1-yl]ethanol.
| Compound Name | 2-[4-(1H-imidazol-5-ylmethyl)piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 115747077 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 2-[4-(1H-imidazol-5-ylmethyl)piperazin-1-yl]ethanol |
| SMILES | OCCN1CCN(Cc2cnc[nH]2)CC1 |
| InChI | InChI=1S/C10H18N4O/c15-6-5-13-1-3-14(4-2-13)8-10-7-11-9-12-10/h7,9,15H,1-6,8H2,(H,11,12) |
| InChIKey | HEEQTJRQVDTDDJ-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 55.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |