About 2,2-dimethylpropyl 4-(1H-imidazol-5-ylmethyl)piperazine-1-carboxylate
2,2-dimethylpropyl 4-(1H-imidazol-5-ylmethyl)piperazine-1-carboxylate (PubChem CID 159801714) has the molecular formula C14H24N4O2
and a molecular weight of 280.37 g/mol. Its IUPAC name is 2,2-dimethylpropyl 4-(1H-imidazol-5-ylmethyl)piperazine-1-carboxylate.
Molecular Properties
| Compound Name | 2,2-dimethylpropyl 4-(1H-imidazol-5-ylmethyl)piperazine-1-carboxylate |
| PubChem CID | 159801714 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 2,2-dimethylpropyl 4-(1H-imidazol-5-ylmethyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)COC(=O)N1CCN(Cc2cnc[nH]2)CC1 |
| InChI | InChI=1S/C14H24N4O2/c1-14(2,3)10-20-13(19)18-6-4-17(5-7-18)9-12-8-15-11-16-12/h8,11H,4-7,9-10H2,1-3H3,(H,15,16) |
| InChIKey | NJWKJJHYHJLUAM-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,2-dimethylpropyl 4-(1H-imidazol-5-ylmethyl)piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylpropyl 4-(1H-imidazol-5-ylmethyl)piperazine-1-carboxylate?
The IUPAC name of 2,2-dimethylpropyl 4-(1H-imidazol-5-ylmethyl)piperazine-1-carboxylate (CID 159801714) is 2,2-dimethylpropyl 4-(1H-imidazol-5-ylmethyl)piperazine-1-carboxylate.
What is the SMILES notation for 2,2-dimethylpropyl 4-(1H-imidazol-5-ylmethyl)piperazine-1-carboxylate?
The canonical SMILES for 2,2-dimethylpropyl 4-(1H-imidazol-5-ylmethyl)piperazine-1-carboxylate is CC(C)(C)COC(=O)N1CCN(Cc2cnc[nH]2)CC1.
What is the InChIKey of 2,2-dimethylpropyl 4-(1H-imidazol-5-ylmethyl)piperazine-1-carboxylate?
The InChIKey is NJWKJJHYHJLUAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N4O2/c1-14(2,3)10-20-13(19)18-6-4-17(5-7-18)9-12-8-15-11-16-12/h8,11H,4-7,9-10H2,1-3H3,(H,15,16).
What are the key properties of 2,2-dimethylpropyl 4-(1H-imidazol-5-ylmethyl)piperazine-1-carboxylate?
2,2-dimethylpropyl 4-(1H-imidazol-5-ylmethyl)piperazine-1-carboxylate has a molecular weight of 280.37 g/mol, XLogP of 1.71, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylpropyl 4-(1H-imidazol-5-ylmethyl)piperazine-1-carboxylate is sourced from PubChem (CID 159801714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).