C14H28N2O2 — CID 159012212
2,2-dimethylpropyl 4-tert-butylpiperazine-1-carboxylate (PubChem CID 159012212) has the molecular formula C14H28N2O2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 2,2-dimethylpropyl 4-tert-butylpiperazine-1-carboxylate.
| Compound Name | 2,2-dimethylpropyl 4-tert-butylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 159012212 |
| Molecular Formula | C14H28N2O2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | 2,2-dimethylpropyl 4-tert-butylpiperazine-1-carboxylate |
| SMILES | CC(C)(C)COC(=O)N1CCN(C(C)(C)C)CC1 |
| InChI | InChI=1S/C14H28N2O2/c1-13(2,3)11-18-12(17)15-7-9-16(10-8-15)14(4,5)6/h7-11H2,1-6H3 |
| InChIKey | PWUYXWKIADDBPX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |