C11H20N4O3S — CID 102955313
4-(3-methoxypiperidin-1-yl)sulfonyl-1,5-dimethylpyrazol-3-amine (PubChem CID 102955313) has the molecular formula C11H20N4O3S and a molecular weight of 288.37 g/mol. Its IUPAC name is 4-(3-methoxypiperidin-1-yl)sulfonyl-1,5-dimethylpyrazol-3-amine.
| Compound Name | 4-(3-methoxypiperidin-1-yl)sulfonyl-1,5-dimethylpyrazol-3-amine |
|---|---|
| PubChem CID | 102955313 |
| Molecular Formula | C11H20N4O3S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 4-(3-methoxypiperidin-1-yl)sulfonyl-1,5-dimethylpyrazol-3-amine |
| SMILES | COC1CCCN(S(=O)(=O)c2c(N)nn(C)c2C)C1 |
| InChI | InChI=1S/C11H20N4O3S/c1-8-10(11(12)13-14(8)2)19(16,17)15-6-4-5-9(7-15)18-3/h9H,4-7H2,1-3H3,(H2,12,13) |
| InChIKey | ALCMFOPQDBYHAN-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |