C15H23N3OS — CID 102957969
2-(3-methoxy-4-methylpiperidin-1-yl)-4,6-dimethylpyridine-3-carbothioamide (PubChem CID 102957969) has the molecular formula C15H23N3OS and a molecular weight of 293.44 g/mol. Its IUPAC name is 2-(3-methoxy-4-methylpiperidin-1-yl)-4,6-dimethylpyridine-3-carbothioamide.
| Compound Name | 2-(3-methoxy-4-methylpiperidin-1-yl)-4,6-dimethylpyridine-3-carbothioamide |
|---|---|
| PubChem CID | 102957969 |
| Molecular Formula | C15H23N3OS |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 2-(3-methoxy-4-methylpiperidin-1-yl)-4,6-dimethylpyridine-3-carbothioamide |
| SMILES | COC1CN(c2nc(C)cc(C)c2C(N)=S)CCC1C |
| InChI | InChI=1S/C15H23N3OS/c1-9-5-6-18(8-12(9)19-4)15-13(14(16)20)10(2)7-11(3)17-15/h7,9,12H,5-6,8H2,1-4H3,(H2,16,20) |
| InChIKey | RFHHXHRMTHPAEX-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|