C14H26BrNO — CID 102962283
1-(3-bromo-4-methylpiperidin-1-yl)-3,4,4-trimethylpentan-1-one (PubChem CID 102962283) has the molecular formula C14H26BrNO and a molecular weight of 304.27 g/mol. Its IUPAC name is 1-(3-bromo-4-methylpiperidin-1-yl)-3,4,4-trimethylpentan-1-one.
| Compound Name | 1-(3-bromo-4-methylpiperidin-1-yl)-3,4,4-trimethylpentan-1-one |
|---|---|
| PubChem CID | 102962283 |
| Molecular Formula | C14H26BrNO |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 1-(3-bromo-4-methylpiperidin-1-yl)-3,4,4-trimethylpentan-1-one |
| SMILES | CC1CCN(C(=O)CC(C)C(C)(C)C)CC1Br |
| InChI | InChI=1S/C14H26BrNO/c1-10-6-7-16(9-12(10)15)13(17)8-11(2)14(3,4)5/h10-12H,6-9H2,1-5H3 |
| InChIKey | CXYMLCSUPPLAFE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|