C16H31NOS — CID 86938379
1-(3-ethylsulfanylazepan-1-yl)-3,4,4-trimethylpentan-1-one (PubChem CID 86938379) has the molecular formula C16H31NOS and a molecular weight of 285.50 g/mol. Its IUPAC name is 1-(3-ethylsulfanylazepan-1-yl)-3,4,4-trimethylpentan-1-one.
| Compound Name | 1-(3-ethylsulfanylazepan-1-yl)-3,4,4-trimethylpentan-1-one |
|---|---|
| PubChem CID | 86938379 |
| Molecular Formula | C16H31NOS |
| Molecular Weight | 285.50 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | 1-(3-ethylsulfanylazepan-1-yl)-3,4,4-trimethylpentan-1-one |
| SMILES | CCSC1CCCCN(C(=O)CC(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C16H31NOS/c1-6-19-14-9-7-8-10-17(12-14)15(18)11-13(2)16(3,4)5/h13-14H,6-12H2,1-5H3 |
| InChIKey | IEBXPSQSGHHATI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |