C13H19N3O2 — CID 102964134
3-amino-2-(3-hydroxy-4-methylpiperidin-1-yl)benzamide (PubChem CID 102964134) has the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. Its IUPAC name is 3-amino-2-(3-hydroxy-4-methylpiperidin-1-yl)benzamide.
| Compound Name | 3-amino-2-(3-hydroxy-4-methylpiperidin-1-yl)benzamide |
|---|---|
| PubChem CID | 102964134 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 3-amino-2-(3-hydroxy-4-methylpiperidin-1-yl)benzamide |
| SMILES | CC1CCN(c2c(N)cccc2C(N)=O)CC1O |
| InChI | InChI=1S/C13H19N3O2/c1-8-5-6-16(7-11(8)17)12-9(13(15)18)3-2-4-10(12)14/h2-4,8,11,17H,5-7,14H2,1H3,(H2,15,18) |
| InChIKey | ZDUDMRFRCRYXPE-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 92.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|