C16H24N4O — CID 115935384
3-amino-2-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)benzamide (PubChem CID 115935384) has the molecular formula C16H24N4O and a molecular weight of 288.39 g/mol. Its IUPAC name is 3-amino-2-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)benzamide.
| Compound Name | 3-amino-2-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)benzamide |
|---|---|
| PubChem CID | 115935384 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | 3-amino-2-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)benzamide |
| SMILES | CN1CCCC2CN(c3c(N)cccc3C(N)=O)CCC21 |
| InChI | InChI=1S/C16H24N4O/c1-19-8-3-4-11-10-20(9-7-14(11)19)15-12(16(18)21)5-2-6-13(15)17/h2,5-6,11,14H,3-4,7-10,17H2,1H3,(H2,18,21) |
| InChIKey | CJIZCNHKCGASOX-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|