C16H21FN2O — CID 102964533
3-[3-fluoro-5-[(3-methoxypiperidin-1-yl)methyl]phenyl]prop-2-yn-1-amine (PubChem CID 102964533) has the molecular formula C16H21FN2O and a molecular weight of 276.36 g/mol. Its IUPAC name is 3-[3-fluoro-5-[(3-methoxypiperidin-1-yl)methyl]phenyl]prop-2-yn-1-amine.
| Compound Name | 3-[3-fluoro-5-[(3-methoxypiperidin-1-yl)methyl]phenyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 102964533 |
| Molecular Formula | C16H21FN2O |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 3-[3-fluoro-5-[(3-methoxypiperidin-1-yl)methyl]phenyl]prop-2-yn-1-amine |
| SMILES | COC1CCCN(Cc2cc(F)cc(C#CCN)c2)C1 |
| InChI | InChI=1S/C16H21FN2O/c1-20-16-5-3-7-19(12-16)11-14-8-13(4-2-6-18)9-15(17)10-14/h8-10,16H,3,5-7,11-12,18H2,1H3 |
| InChIKey | PJCGHPLOSAVBDT-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|