C17H24N2O2 — CID 102964528
3-[4-methoxy-2-[(3-methoxypiperidin-1-yl)methyl]phenyl]prop-2-yn-1-amine (PubChem CID 102964528) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 3-[4-methoxy-2-[(3-methoxypiperidin-1-yl)methyl]phenyl]prop-2-yn-1-amine.
| Compound Name | 3-[4-methoxy-2-[(3-methoxypiperidin-1-yl)methyl]phenyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 102964528 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 3-[4-methoxy-2-[(3-methoxypiperidin-1-yl)methyl]phenyl]prop-2-yn-1-amine |
| SMILES | COc1ccc(C#CCN)c(CN2CCCC(OC)C2)c1 |
| InChI | InChI=1S/C17H24N2O2/c1-20-16-8-7-14(5-3-9-18)15(11-16)12-19-10-4-6-17(13-19)21-2/h7-8,11,17H,4,6,9-10,12-13,18H2,1-2H3 |
| InChIKey | HGXRFVIZMZTPMC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|