C17H23NO3 — CID 102964619
3-[2-methoxy-5-[(3-methoxypiperidin-1-yl)methyl]phenyl]prop-2-yn-1-ol (PubChem CID 102964619) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is 3-[2-methoxy-5-[(3-methoxypiperidin-1-yl)methyl]phenyl]prop-2-yn-1-ol.
| Compound Name | 3-[2-methoxy-5-[(3-methoxypiperidin-1-yl)methyl]phenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 102964619 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 3-[2-methoxy-5-[(3-methoxypiperidin-1-yl)methyl]phenyl]prop-2-yn-1-ol |
| SMILES | COc1ccc(CN2CCCC(OC)C2)cc1C#CCO |
| InChI | InChI=1S/C17H23NO3/c1-20-16-6-3-9-18(13-16)12-14-7-8-17(21-2)15(11-14)5-4-10-19/h7-8,11,16,19H,3,6,9-10,12-13H2,1-2H3 |
| InChIKey | YYWKDKGKGNMHMV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|