C16H23NO5 — CID 125443053
2-[2-methoxy-4-[[(3R)-3-methoxypiperidin-1-yl]methyl]phenoxy]acetic acid (PubChem CID 125443053) has the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. Its IUPAC name is 2-[2-methoxy-4-[[(3R)-3-methoxypiperidin-1-yl]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-methoxy-4-[[(3R)-3-methoxypiperidin-1-yl]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 125443053 |
| Molecular Formula | C16H23NO5 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 2-[2-methoxy-4-[[(3R)-3-methoxypiperidin-1-yl]methyl]phenoxy]acetic acid |
| SMILES | COc1cc(CN2CCC[C@@H](OC)C2)ccc1OCC(=O)O |
| InChI | InChI=1S/C16H23NO5/c1-20-13-4-3-7-17(10-13)9-12-5-6-14(15(8-12)21-2)22-11-16(18)19/h5-6,8,13H,3-4,7,9-11H2,1-2H3,(H,18,19)/t13-/m1/s1 |
| InChIKey | UEYYPFYOXZLUSP-CYBMUJFWSA-N |
| XLogP | 1.77 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |