C20H23F2NO2 — CID 162627048
1-[[4-fluoro-3-(3-fluoro-4-methoxyphenyl)phenyl]methyl]-3-methoxypiperidine (PubChem CID 162627048) has the molecular formula C20H23F2NO2 and a molecular weight of 347.41 g/mol. Its IUPAC name is 1-[[4-fluoro-3-(3-fluoro-4-methoxyphenyl)phenyl]methyl]-3-methoxypiperidine.
| Compound Name | 1-[[4-fluoro-3-(3-fluoro-4-methoxyphenyl)phenyl]methyl]-3-methoxypiperidine |
|---|---|
| PubChem CID | 162627048 |
| Molecular Formula | C20H23F2NO2 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 1-[[4-fluoro-3-(3-fluoro-4-methoxyphenyl)phenyl]methyl]-3-methoxypiperidine |
| SMILES | COc1ccc(-c2cc(CN3CCCC(OC)C3)ccc2F)cc1F |
| InChI | InChI=1S/C20H23F2NO2/c1-24-16-4-3-9-23(13-16)12-14-5-7-18(21)17(10-14)15-6-8-20(25-2)19(22)11-15/h5-8,10-11,16H,3-4,9,12-13H2,1-2H3 |
| InChIKey | IULGSOMLJMONRH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |