C17H22O2S — CID 63120155
3-[5-(cyclopentylmethylsulfanylmethyl)-2-methoxyphenyl]prop-2-yn-1-ol (PubChem CID 63120155) has the molecular formula C17H22O2S and a molecular weight of 290.43 g/mol. Its IUPAC name is 3-[5-(cyclopentylmethylsulfanylmethyl)-2-methoxyphenyl]prop-2-yn-1-ol.
| Compound Name | 3-[5-(cyclopentylmethylsulfanylmethyl)-2-methoxyphenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 63120155 |
| Molecular Formula | C17H22O2S |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 3-[5-(cyclopentylmethylsulfanylmethyl)-2-methoxyphenyl]prop-2-yn-1-ol |
| SMILES | COc1ccc(CSCC2CCCC2)cc1C#CCO |
| InChI | InChI=1S/C17H22O2S/c1-19-17-9-8-15(11-16(17)7-4-10-18)13-20-12-14-5-2-3-6-14/h8-9,11,14,18H,2-3,5-6,10,12-13H2,1H3 |
| InChIKey | KNUZCBNXWCRTRI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|