C17H34N2O — CID 102964786
[1-(3-methoxy-4-methylpiperidin-1-yl)-4-propylcyclohexyl]methanamine (PubChem CID 102964786) has the molecular formula C17H34N2O and a molecular weight of 282.47 g/mol. Its IUPAC name is [1-(3-methoxy-4-methylpiperidin-1-yl)-4-propylcyclohexyl]methanamine.
| Compound Name | [1-(3-methoxy-4-methylpiperidin-1-yl)-4-propylcyclohexyl]methanamine |
|---|---|
| PubChem CID | 102964786 |
| Molecular Formula | C17H34N2O |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.27 |
| IUPAC Name | [1-(3-methoxy-4-methylpiperidin-1-yl)-4-propylcyclohexyl]methanamine |
| SMILES | CCCC1CCC(CN)(N2CCC(C)C(OC)C2)CC1 |
| InChI | InChI=1S/C17H34N2O/c1-4-5-15-6-9-17(13-18,10-7-15)19-11-8-14(2)16(12-19)20-3/h14-16H,4-13,18H2,1-3H3 |
| InChIKey | JFEQCCSDEAWMNQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |