About [1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4-propylcycloheptyl]methanamine
[1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4-propylcycloheptyl]methanamine (PubChem CID 104958066) has the molecular formula C17H34N2O
and a molecular weight of 282.47 g/mol. Its IUPAC name is [1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4-propylcycloheptyl]methanamine.
Molecular Properties
| Compound Name | [1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4-propylcycloheptyl]methanamine |
| PubChem CID | 104958066 |
| Molecular Formula | C17H34N2O |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.27 |
| IUPAC Name | [1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4-propylcycloheptyl]methanamine |
| SMILES | CCCC1CCCC(CN)(N2C[C@@H](C)O[C@@H](C)C2)CC1 |
| InChI | InChI=1S/C17H34N2O/c1-4-6-16-7-5-9-17(13-18,10-8-16)19-11-14(2)20-15(3)12-19/h14-16H,4-13,18H2,1-3H3/t14-,15+,16?,17? |
| InChIKey | HYQFAJCUHSIECT-RYTJFDOTSA-N |
| XLogP | 3.17 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4-propylcycloheptyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4-propylcycloheptyl]methanamine?
The IUPAC name of [1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4-propylcycloheptyl]methanamine (CID 104958066) is [1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4-propylcycloheptyl]methanamine.
What is the SMILES notation for [1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4-propylcycloheptyl]methanamine?
The canonical SMILES for [1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4-propylcycloheptyl]methanamine is CCCC1CCCC(CN)(N2C[C@@H](C)O[C@@H](C)C2)CC1.
What is the InChIKey of [1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4-propylcycloheptyl]methanamine?
The InChIKey is HYQFAJCUHSIECT-RYTJFDOTSA-N. The full InChI is InChI=1S/C17H34N2O/c1-4-6-16-7-5-9-17(13-18,10-8-16)19-11-14(2)20-15(3)12-19/h14-16H,4-13,18H2,1-3H3/t14-,15+,16?,17?.
What are the key properties of [1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4-propylcycloheptyl]methanamine?
[1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4-propylcycloheptyl]methanamine has a molecular weight of 282.47 g/mol, XLogP of 3.17, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4-propylcycloheptyl]methanamine is sourced from PubChem (CID 104958066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).