C10H20N2O3 — CID 102964894
3-amino-2-(3-methoxy-4-methylpiperidin-1-yl)propanoic acid (PubChem CID 102964894) has the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. Its IUPAC name is 3-amino-2-(3-methoxy-4-methylpiperidin-1-yl)propanoic acid.
| Compound Name | 3-amino-2-(3-methoxy-4-methylpiperidin-1-yl)propanoic acid |
|---|---|
| PubChem CID | 102964894 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 3-amino-2-(3-methoxy-4-methylpiperidin-1-yl)propanoic acid |
| SMILES | COC1CN(C(CN)C(=O)O)CCC1C |
| InChI | InChI=1S/C10H20N2O3/c1-7-3-4-12(6-9(7)15-2)8(5-11)10(13)14/h7-9H,3-6,11H2,1-2H3,(H,13,14) |
| InChIKey | JJKAQFJMCOIDCE-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |