C13H28N2O2 — CID 102968987
1-amino-4-(3-methoxy-4-methylpiperidin-1-yl)-2-methylpentan-2-ol (PubChem CID 102968987) has the molecular formula C13H28N2O2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 1-amino-4-(3-methoxy-4-methylpiperidin-1-yl)-2-methylpentan-2-ol.
| Compound Name | 1-amino-4-(3-methoxy-4-methylpiperidin-1-yl)-2-methylpentan-2-ol |
|---|---|
| PubChem CID | 102968987 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | 1-amino-4-(3-methoxy-4-methylpiperidin-1-yl)-2-methylpentan-2-ol |
| SMILES | COC1CN(C(C)CC(C)(O)CN)CCC1C |
| InChI | InChI=1S/C13H28N2O2/c1-10-5-6-15(8-12(10)17-4)11(2)7-13(3,16)9-14/h10-12,16H,5-9,14H2,1-4H3 |
| InChIKey | VWEGFOWRTISDCT-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |