C12H19ClN2OS — CID 102965116
2-(4-chlorothiophen-2-yl)-2-(3-methoxypiperidin-1-yl)ethanamine (PubChem CID 102965116) has the molecular formula C12H19ClN2OS and a molecular weight of 274.82 g/mol. Its IUPAC name is 2-(4-chlorothiophen-2-yl)-2-(3-methoxypiperidin-1-yl)ethanamine.
| Compound Name | 2-(4-chlorothiophen-2-yl)-2-(3-methoxypiperidin-1-yl)ethanamine |
|---|---|
| PubChem CID | 102965116 |
| Molecular Formula | C12H19ClN2OS |
| Molecular Weight | 274.82 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 2-(4-chlorothiophen-2-yl)-2-(3-methoxypiperidin-1-yl)ethanamine |
| SMILES | COC1CCCN(C(CN)c2cc(Cl)cs2)C1 |
| InChI | InChI=1S/C12H19ClN2OS/c1-16-10-3-2-4-15(7-10)11(6-14)12-5-9(13)8-17-12/h5,8,10-11H,2-4,6-7,14H2,1H3 |
| InChIKey | RJSHVMHVMJQIQI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.82 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |