C10H19N3S — CID 102969725
2-methyl-1-[3-(2-methylsulfanylethyl)imidazol-4-yl]propan-1-amine (PubChem CID 102969725) has the molecular formula C10H19N3S and a molecular weight of 213.35 g/mol. Its IUPAC name is 2-methyl-1-[3-(2-methylsulfanylethyl)imidazol-4-yl]propan-1-amine.
| Compound Name | 2-methyl-1-[3-(2-methylsulfanylethyl)imidazol-4-yl]propan-1-amine |
|---|---|
| PubChem CID | 102969725 |
| Molecular Formula | C10H19N3S |
| Molecular Weight | 213.35 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 2-methyl-1-[3-(2-methylsulfanylethyl)imidazol-4-yl]propan-1-amine |
| SMILES | CSCCn1cncc1C(N)C(C)C |
| InChI | InChI=1S/C10H19N3S/c1-8(2)10(11)9-6-12-7-13(9)4-5-14-3/h6-8,10H,4-5,11H2,1-3H3 |
| InChIKey | YBTOJPXJFDNQLK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |